C22H29N2O4+ — CID 6993162
6-[(R)-[4-(diethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]-1,3-benzodioxol-5-ol (PubChem CID 6993162) has the molecular formula C22H29N2O4+ and a molecular weight of 385.48 g/mol. Its IUPAC name is 6-[(R)-[4-(diethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[(R)-[4-(diethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 6993162 |
| Molecular Formula | C22H29N2O4+ |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 6-[(R)-[4-(diethylamino)phenyl]-morpholin-4-ium-4-ylmethyl]-1,3-benzodioxol-5-ol |
| SMILES | CCN(CC)c1ccc([C@H](c2cc3c(cc2O)OCO3)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-3-23(4-2)17-7-5-16(6-8-17)22(24-9-11-26-12-10-24)18-13-20-21(14-19(18)25)28-15-27-20/h5-8,13-14,22,25H,3-4,9-12,15H2,1-2H3/p+1/t22-/m1/s1 |
| InChIKey | WJLSUMKZPXUAKY-JOCHJYFZSA-O |
| XLogP | 1.97 |
| TPSA | 55.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|