C22H26N3O6+ — CID 3364969
2-morpholin-4-ium-4-yl-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 3364969) has the molecular formula C22H26N3O6+ and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-morpholin-4-ium-4-yl-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-morpholin-4-ium-4-yl-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 3364969 |
| Molecular Formula | C22H26N3O6+ |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-morpholin-4-ium-4-yl-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)C(c2cc3c(cc2[N+](=O)[O-])OCO3)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25N3O6/c1-14(2)15-3-5-16(6-4-15)23-22(26)21(24-7-9-29-10-8-24)17-11-19-20(31-13-30-19)12-18(17)25(27)28/h3-6,11-12,14,21H,7-10,13H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | ODKOWQPPKPLIKQ-UHFFFAOYSA-O |
| XLogP | 2.04 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|