C31H29N3O5 — CID 5098811
2-(N-benzylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide (PubChem CID 5098811) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is 2-(N-benzylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide.
| Compound Name | 2-(N-benzylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 5098811 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 2-(N-benzylanilino)-2-(6-nitro-1,3-benzodioxol-5-yl)-N-(4-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccc(NC(=O)C(c2cc3c(cc2[N+](=O)[O-])OCO3)N(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H29N3O5/c1-21(2)23-13-15-24(16-14-23)32-31(35)30(26-17-28-29(39-20-38-28)18-27(26)34(36)37)33(25-11-7-4-8-12-25)19-22-9-5-3-6-10-22/h3-18,21,30H,19-20H2,1-2H3,(H,32,35) |
| InChIKey | DQSFGILNNUFODR-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|