C24H22N2O8 — CID 17367398
N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2-diphenylethanamine;oxalic acid (PubChem CID 17367398) has the molecular formula C24H22N2O8 and a molecular weight of 466.45 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2-diphenylethanamine;oxalic acid.
| Compound Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2-diphenylethanamine;oxalic acid |
|---|---|
| PubChem CID | 17367398 |
| Molecular Formula | C24H22N2O8 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1,2-diphenylethanamine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1cc2c(cc1CNC(Cc1ccccc1)c1ccccc1)OCO2 |
| InChI | InChI=1S/C22H20N2O4.C2H2O4/c25-24(26)20-13-22-21(27-15-28-22)12-18(20)14-23-19(17-9-5-2-6-10-17)11-16-7-3-1-4-8-16;3-1(4)2(5)6/h1-10,12-13,19,23H,11,14-15H2;(H,3,4)(H,5,6) |
| InChIKey | PPVJFIPDCUXXLN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|