C17H15FN2O8 — CID 11958704
4-fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline;oxalic acid (PubChem CID 11958704) has the molecular formula C17H15FN2O8 and a molecular weight of 394.31 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline;oxalic acid.
| Compound Name | 4-fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline;oxalic acid |
|---|---|
| PubChem CID | 11958704 |
| Molecular Formula | C17H15FN2O8 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 4-fluoro-2-methyl-N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]aniline;oxalic acid |
| SMILES | Cc1cc(F)ccc1NCc1cc2c(cc1[N+](=O)[O-])OCO2.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H13FN2O4.C2H2O4/c1-9-4-11(16)2-3-12(9)17-7-10-5-14-15(22-8-21-14)6-13(10)18(19)20;3-1(4)2(5)6/h2-6,17H,7-8H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JPWDKZJMLXXCNK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 148.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|