C15H18N2O9 — CID 126468065
N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1-(oxolan-2-yl)methanamine;oxalic acid (PubChem CID 126468065) has the molecular formula C15H18N2O9 and a molecular weight of 370.31 g/mol. Its IUPAC name is N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1-(oxolan-2-yl)methanamine;oxalic acid.
| Compound Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1-(oxolan-2-yl)methanamine;oxalic acid |
|---|---|
| PubChem CID | 126468065 |
| Molecular Formula | C15H18N2O9 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-[(6-nitro-1,3-benzodioxol-5-yl)methyl]-1-(oxolan-2-yl)methanamine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1cc2c(cc1CNCC1CCCO1)OCO2 |
| InChI | InChI=1S/C13H16N2O5.C2H2O4/c16-15(17)11-5-13-12(19-8-20-13)4-9(11)6-14-7-10-2-1-3-18-10;3-1(4)2(5)6/h4-5,10,14H,1-3,6-8H2;(H,3,4)(H,5,6) |
| InChIKey | QOLTUWDQQNPEHX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 157.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|