C24H25N3O6 — CID 67748546
(2S)-1-(2-amino-3-nitrophenoxy)-3-[[(1R)-1-(1,3-benzodioxol-5-yl)-2-phenylethyl]amino]propan-2-ol (PubChem CID 67748546) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is (2S)-1-(2-amino-3-nitrophenoxy)-3-[[(1R)-1-(1,3-benzodioxol-5-yl)-2-phenylethyl]amino]propan-2-ol.
| Compound Name | (2S)-1-(2-amino-3-nitrophenoxy)-3-[[(1R)-1-(1,3-benzodioxol-5-yl)-2-phenylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 67748546 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | (2S)-1-(2-amino-3-nitrophenoxy)-3-[[(1R)-1-(1,3-benzodioxol-5-yl)-2-phenylethyl]amino]propan-2-ol |
| SMILES | Nc1c(OC[C@@H](O)CN[C@H](Cc2ccccc2)c2ccc3c(c2)OCO3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H25N3O6/c25-24-20(27(29)30)7-4-8-22(24)31-14-18(28)13-26-19(11-16-5-2-1-3-6-16)17-9-10-21-23(12-17)33-15-32-21/h1-10,12,18-19,26,28H,11,13-15,25H2/t18-,19+/m0/s1 |
| InChIKey | YTKKUUXOLOBYFA-RBUKOAKNSA-N |
| XLogP | 3.22 |
| TPSA | 129.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|