C21H20N2O2 — CID 2851831
N-[(2-nitrophenyl)methyl]-1,2-diphenylethanamine (PubChem CID 2851831) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[(2-nitrophenyl)methyl]-1,2-diphenylethanamine.
| Compound Name | N-[(2-nitrophenyl)methyl]-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 2851831 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-[(2-nitrophenyl)methyl]-1,2-diphenylethanamine |
| SMILES | O=[N+]([O-])c1ccccc1CNC(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c24-23(25)21-14-8-7-13-19(21)16-22-20(18-11-5-2-6-12-18)15-17-9-3-1-4-10-17/h1-14,20,22H,15-16H2 |
| InChIKey | TXXPHWMGKXGHGL-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|