C21H27ClN2O2 — CID 12915162
N-(cyclohexylmethyl)-2-(2-nitrophenyl)-1-phenylethanamine;hydrochloride (PubChem CID 12915162) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(2-nitrophenyl)-1-phenylethanamine;hydrochloride.
| Compound Name | N-(cyclohexylmethyl)-2-(2-nitrophenyl)-1-phenylethanamine;hydrochloride |
|---|---|
| PubChem CID | 12915162 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(2-nitrophenyl)-1-phenylethanamine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccccc1CC(NCC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2.ClH/c24-23(25)21-14-8-7-13-19(21)15-20(18-11-5-2-6-12-18)22-16-17-9-3-1-4-10-17;/h2,5-8,11-14,17,20,22H,1,3-4,9-10,15-16H2;1H |
| InChIKey | WUEPEYRAIWQSFG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|