C16H17NO3 — CID 16789877
1-(1,3-benzodioxol-5-yl)-2-(2-methylphenoxy)ethanamine (PubChem CID 16789877) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(2-methylphenoxy)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methylphenoxy)ethanamine |
|---|---|
| PubChem CID | 16789877 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(2-methylphenoxy)ethanamine |
| SMILES | Cc1ccccc1OCC(N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H17NO3/c1-11-4-2-3-5-14(11)18-9-13(17)12-6-7-15-16(8-12)20-10-19-15/h2-8,13H,9-10,17H2,1H3 |
| InChIKey | XREHSJRLTVADRG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |