C15H23NO3 — CID 43184290
1-(1,3-benzodioxol-5-yl)-2-(4-methylpentan-2-yloxy)ethanamine (PubChem CID 43184290) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-(4-methylpentan-2-yloxy)ethanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methylpentan-2-yloxy)ethanamine |
|---|---|
| PubChem CID | 43184290 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-(4-methylpentan-2-yloxy)ethanamine |
| SMILES | CC(C)CC(C)OCC(N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H23NO3/c1-10(2)6-11(3)17-8-13(16)12-4-5-14-15(7-12)19-9-18-14/h4-5,7,10-11,13H,6,8-9,16H2,1-3H3 |
| InChIKey | DLBSMRCIBVXHSL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |