C16H22N2O6 — CID 139899877
[3-amino-3-(1,3-benzodioxol-5-yl)propanoyl] 2-amino-4-methylpentaneperoxoate (PubChem CID 139899877) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is [3-amino-3-(1,3-benzodioxol-5-yl)propanoyl] 2-amino-4-methylpentaneperoxoate.
| Compound Name | [3-amino-3-(1,3-benzodioxol-5-yl)propanoyl] 2-amino-4-methylpentaneperoxoate |
|---|---|
| PubChem CID | 139899877 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [3-amino-3-(1,3-benzodioxol-5-yl)propanoyl] 2-amino-4-methylpentaneperoxoate |
| SMILES | CC(C)CC(N)C(=O)OOC(=O)CC(N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H22N2O6/c1-9(2)5-12(18)16(20)24-23-15(19)7-11(17)10-3-4-13-14(6-10)22-8-21-13/h3-4,6,9,11-12H,5,7-8,17-18H2,1-2H3 |
| InChIKey | YYVXQTOWALNYAC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|