C19H23N3O4+2 — CID 7439806
1-benzyl-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine-1,4-diium (PubChem CID 7439806) has the molecular formula C19H23N3O4+2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-benzyl-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine-1,4-diium.
| Compound Name | 1-benzyl-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7439806 |
| Molecular Formula | C19H23N3O4+2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | 1-benzyl-4-[(6-nitro-1,3-benzodioxol-5-yl)methyl]piperazine-1,4-diium |
| SMILES | O=[N+]([O-])c1cc2c(cc1C[NH+]1CC[NH+](Cc3ccccc3)CC1)OCO2 |
| InChI | InChI=1S/C19H21N3O4/c23-22(24)17-11-19-18(25-14-26-19)10-16(17)13-21-8-6-20(7-9-21)12-15-4-2-1-3-5-15/h1-5,10-11H,6-9,12-14H2/p+2 |
| InChIKey | PVVKLIZOBXBTER-UHFFFAOYSA-P |
| XLogP | -0.19 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|