C21H29N3O4+2 — CID 4755043
1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(4-methylphenyl)methyl]piperazine-1,4-diium (PubChem CID 4755043) has the molecular formula C21H29N3O4+2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(4-methylphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(4-methylphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 4755043 |
| Molecular Formula | C21H29N3O4+2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 1-[(4,5-dimethoxy-2-nitrophenyl)methyl]-4-[(4-methylphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1cc(C[NH+]2CC[NH+](Cc3ccc(C)cc3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H27N3O4/c1-16-4-6-17(7-5-16)14-22-8-10-23(11-9-22)15-18-12-20(27-2)21(28-3)13-19(18)24(25)26/h4-7,12-13H,8-11,14-15H2,1-3H3/p+2 |
| InChIKey | JZRHAPUVZGGWOG-UHFFFAOYSA-P |
| XLogP | 0.40 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|