C21H29N3O5+2 — CID 7334360
1-[(2-nitrophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium (PubChem CID 7334360) has the molecular formula C21H29N3O5+2 and a molecular weight of 403.48 g/mol. Its IUPAC name is 1-[(2-nitrophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium.
| Compound Name | 1-[(2-nitrophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium |
|---|---|
| PubChem CID | 7334360 |
| Molecular Formula | C21H29N3O5+2 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 1-[(2-nitrophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine-1,4-diium |
| SMILES | COc1ccc(C[NH+]2CC[NH+](Cc3ccccc3[N+](=O)[O-])CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H27N3O5/c1-27-19-9-8-17(20(28-2)21(19)29-3)15-23-12-10-22(11-13-23)14-16-6-4-5-7-18(16)24(25)26/h4-9H,10-15H2,1-3H3/p+2 |
| InChIKey | RJTJBQLTFGZYIV-UHFFFAOYSA-P |
| XLogP | 0.10 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|