C14H22NO3S+ — CID 6939451
4-[(2,3,4-trimethoxyphenyl)methyl]thiomorpholin-4-ium (PubChem CID 6939451) has the molecular formula C14H22NO3S+ and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-[(2,3,4-trimethoxyphenyl)methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(2,3,4-trimethoxyphenyl)methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 6939451 |
| Molecular Formula | C14H22NO3S+ |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[(2,3,4-trimethoxyphenyl)methyl]thiomorpholin-4-ium |
| SMILES | COc1ccc(C[NH+]2CCSCC2)c(OC)c1OC |
| InChI | InChI=1S/C14H21NO3S/c1-16-12-5-4-11(13(17-2)14(12)18-3)10-15-6-8-19-9-7-15/h4-5H,6-10H2,1-3H3/p+1 |
| InChIKey | ZVRNIKGVKOYWSM-UHFFFAOYSA-O |
| XLogP | 0.84 |
| TPSA | 32.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |