C14H22NO2S+ — CID 6937356
4-[(2,4-dimethoxy-3-methylphenyl)methyl]thiomorpholin-4-ium (PubChem CID 6937356) has the molecular formula C14H22NO2S+ and a molecular weight of 268.40 g/mol. Its IUPAC name is 4-[(2,4-dimethoxy-3-methylphenyl)methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(2,4-dimethoxy-3-methylphenyl)methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 6937356 |
| Molecular Formula | C14H22NO2S+ |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 4-[(2,4-dimethoxy-3-methylphenyl)methyl]thiomorpholin-4-ium |
| SMILES | COc1ccc(C[NH+]2CCSCC2)c(OC)c1C |
| InChI | InChI=1S/C14H21NO2S/c1-11-13(16-2)5-4-12(14(11)17-3)10-15-6-8-18-9-7-15/h4-5H,6-10H2,1-3H3/p+1 |
| InChIKey | DSWMCAPJPSPBDR-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |