C21H25N2O2+ — CID 7446469
2-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 7446469) has the molecular formula C21H25N2O2+ and a molecular weight of 337.44 g/mol. Its IUPAC name is 2-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 7446469 |
| Molecular Formula | C21H25N2O2+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | 2-[(2,4-dimethoxy-3-methylphenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | COc1ccc(C[NH+]2CCc3c([nH]c4ccccc34)C2)c(OC)c1C |
| InChI | InChI=1S/C21H24N2O2/c1-14-20(24-2)9-8-15(21(14)25-3)12-23-11-10-17-16-6-4-5-7-18(16)22-19(17)13-23/h4-9,22H,10-13H2,1-3H3/p+1 |
| InChIKey | WNPVLKRCYNABSL-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|