C18H17ClFN2+ — CID 6962666
2-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium (PubChem CID 6962666) has the molecular formula C18H17ClFN2+ and a molecular weight of 315.80 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
|---|---|
| PubChem CID | 6962666 |
| Molecular Formula | C18H17ClFN2+ |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-2-ium |
| SMILES | Fc1cccc(Cl)c1C[NH+]1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C18H16ClFN2/c19-15-5-3-6-16(20)14(15)10-22-9-8-13-12-4-1-2-7-17(12)21-18(13)11-22/h1-7,21H,8-11H2/p+1 |
| InChIKey | LERCMDKITYSXGB-UHFFFAOYSA-O |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|