C11H13N — CID 162302713
molecular hydrogen;1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 162302713) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is molecular hydrogen;1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | molecular hydrogen;1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 162302713 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | molecular hydrogen;1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | [H][H].c1ccc2c3c([nH]c2c1)CCC3 |
| InChI | InChI=1S/C11H11N.H2/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10;/h1-2,4,6,12H,3,5,7H2;1H |
| InChIKey | BAZKALHLOFVXHN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|