C24H22N4 — CID 135400598
(Z)-N-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]-2,3,4,9-tetrahydrocarbazol-1-imine (PubChem CID 135400598) has the molecular formula C24H22N4 and a molecular weight of 366.47 g/mol. Its IUPAC name is (Z)-N-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]-2,3,4,9-tetrahydrocarbazol-1-imine.
| Compound Name | (Z)-N-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]-2,3,4,9-tetrahydrocarbazol-1-imine |
|---|---|
| PubChem CID | 135400598 |
| Molecular Formula | C24H22N4 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | (Z)-N-[(Z)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino]-2,3,4,9-tetrahydrocarbazol-1-imine |
| SMILES | c1ccc2c3c([nH]c2c1)/C(=N\N=C1\CCCc2c1[nH]c1ccccc21)CCC3 |
| InChI | InChI=1S/C24H22N4/c1-3-11-19-15(7-1)17-9-5-13-21(23(17)25-19)27-28-22-14-6-10-18-16-8-2-4-12-20(16)26-24(18)22/h1-4,7-8,11-12,25-26H,5-6,9-10,13-14H2/b27-21-,28-22- |
| InChIKey | FNXQLTBZJPOLSF-ZDSKVHJSSA-N |
| XLogP | 5.52 |
| TPSA | 56.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|