C12H11NS — CID 686232
1,2,3,5-tetrahydrocyclopenta[c]quinoline-4-thione (PubChem CID 686232) has the molecular formula C12H11NS and a molecular weight of 201.29 g/mol. Its IUPAC name is 1,2,3,5-tetrahydrocyclopenta[c]quinoline-4-thione.
| Compound Name | 1,2,3,5-tetrahydrocyclopenta[c]quinoline-4-thione |
|---|---|
| PubChem CID | 686232 |
| Molecular Formula | C12H11NS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 1,2,3,5-tetrahydrocyclopenta[c]quinoline-4-thione |
| SMILES | S=c1[nH]c2ccccc2c2c1CCC2 |
| InChI | InChI=1S/C12H11NS/c14-12-10-6-3-5-8(10)9-4-1-2-7-11(9)13-12/h1-2,4,7H,3,5-6H2,(H,13,14) |
| InChIKey | INEAHZZJVBJVOH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|