C14H19ClN2 — CID 67693209
cyclopropanamine;1,2,3,4-tetrahydrocyclopenta[b]indole;hydrochloride (PubChem CID 67693209) has the molecular formula C14H19ClN2 and a molecular weight of 250.77 g/mol. Its IUPAC name is cyclopropanamine;1,2,3,4-tetrahydrocyclopenta[b]indole;hydrochloride.
| Compound Name | cyclopropanamine;1,2,3,4-tetrahydrocyclopenta[b]indole;hydrochloride |
|---|---|
| PubChem CID | 67693209 |
| Molecular Formula | C14H19ClN2 |
| Molecular Weight | 250.77 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | cyclopropanamine;1,2,3,4-tetrahydrocyclopenta[b]indole;hydrochloride |
| SMILES | Cl.NC1CC1.c1ccc2c3c([nH]c2c1)CCC3 |
| InChI | InChI=1S/C11H11N.C3H7N.ClH/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10;4-3-1-2-3;/h1-2,4,6,12H,3,5,7H2;3H,1-2,4H2;1H |
| InChIKey | OWQNHWQBHFQNCR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|