C13H14ClNO — CID 142809398
2,3,4,5-tetrahydro-1H-phenanthridin-6-one;hydrochloride (PubChem CID 142809398) has the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. Its IUPAC name is 2,3,4,5-tetrahydro-1H-phenanthridin-6-one;hydrochloride.
| Compound Name | 2,3,4,5-tetrahydro-1H-phenanthridin-6-one;hydrochloride |
|---|---|
| PubChem CID | 142809398 |
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.71 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 2,3,4,5-tetrahydro-1H-phenanthridin-6-one;hydrochloride |
| SMILES | Cl.O=c1[nH]c2c(c3ccccc13)CCCC2 |
| InChI | InChI=1S/C13H13NO.ClH/c15-13-11-7-2-1-5-9(11)10-6-3-4-8-12(10)14-13;/h1-2,5,7H,3-4,6,8H2,(H,14,15);1H |
| InChIKey | SBGWGOUQZKALAQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |