C17H14N2O3 — CID 135478084
[(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino] furan-2-carboxylate (PubChem CID 135478084) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is [(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino] furan-2-carboxylate.
| Compound Name | [(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino] furan-2-carboxylate |
|---|---|
| PubChem CID | 135478084 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [(E)-2,3,4,9-tetrahydrocarbazol-1-ylideneamino] furan-2-carboxylate |
| SMILES | O=C(O/N=C1\CCCc2c1[nH]c1ccccc21)c1ccco1 |
| InChI | InChI=1S/C17H14N2O3/c20-17(15-9-4-10-21-15)22-19-14-8-3-6-12-11-5-1-2-7-13(11)18-16(12)14/h1-2,4-5,7,9-10,18H,3,6,8H2/b19-14+ |
| InChIKey | PWXIMPXOMKIZHQ-XMHGGMMESA-N |
| XLogP | 3.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|