C19H14Cl2N2O2 — CID 135954526
[(Z)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 2,6-dichlorobenzoate (PubChem CID 135954526) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 373.24 g/mol. Its IUPAC name is [(Z)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 2,6-dichlorobenzoate.
| Compound Name | [(Z)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 135954526 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | [(Z)-1,2,3,9-tetrahydrocarbazol-4-ylideneamino] 2,6-dichlorobenzoate |
| SMILES | O=C(O/N=C1/CCCc2[nH]c3ccccc3c21)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O2/c20-12-6-3-7-13(21)18(12)19(24)25-23-16-10-4-9-15-17(16)11-5-1-2-8-14(11)22-15/h1-3,5-8,22H,4,9-10H2/b23-16- |
| InChIKey | POXRCHWHPBJSBA-KQWNVCNZSA-N |
| XLogP | 5.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|