C14H16N2O — CID 24974790
1-(3,4,5,6-tetrahydro-2H-azepino[3,2-b]indol-1-yl)ethanone (PubChem CID 24974790) has the molecular formula C14H16N2O and a molecular weight of 228.30 g/mol. Its IUPAC name is 1-(3,4,5,6-tetrahydro-2H-azepino[3,2-b]indol-1-yl)ethanone.
| Compound Name | 1-(3,4,5,6-tetrahydro-2H-azepino[3,2-b]indol-1-yl)ethanone |
|---|---|
| PubChem CID | 24974790 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(3,4,5,6-tetrahydro-2H-azepino[3,2-b]indol-1-yl)ethanone |
| SMILES | CC(=O)N1CCCCc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C14H16N2O/c1-10(17)16-9-5-4-8-13-14(16)11-6-2-3-7-12(11)15-13/h2-3,6-7,15H,4-5,8-9H2,1H3 |
| InChIKey | XYWTWQMHSQZKEB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |