C21H21N3O3S — CID 113089922
1-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)-2,3-dihydroindol-1-yl]ethanone (PubChem CID 113089922) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 1-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 113089922 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[5-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylsulfonyl)-2,3-dihydroindol-1-yl]ethanone |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)N3CCc4c([nH]c5ccccc45)C3)ccc21 |
| InChI | InChI=1S/C21H21N3O3S/c1-14(25)24-11-8-15-12-16(6-7-21(15)24)28(26,27)23-10-9-18-17-4-2-3-5-19(17)22-20(18)13-23/h2-7,12,22H,8-11,13H2,1H3 |
| InChIKey | YKCBEZDOTKBMSJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|