C20H19N3O3S — CID 24590338
6-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylsulfonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 24590338) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 6-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylsulfonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylsulfonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 24590338 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 6-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-ylsulfonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2cc(S(=O)(=O)N3CCc4[nH]c5ccccc5c4C3)ccc2N1 |
| InChI | InChI=1S/C20H19N3O3S/c24-20-8-5-13-11-14(6-7-17(13)22-20)27(25,26)23-10-9-19-16(12-23)15-3-1-2-4-18(15)21-19/h1-4,6-7,11,21H,5,8-10,12H2,(H,22,24) |
| InChIKey | CJELSFAIYJFYBO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|