C19H16FN3O3S — CID 113089764
5-[(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one (PubChem CID 113089764) has the molecular formula C19H16FN3O3S and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-[(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 113089764 |
| Molecular Formula | C19H16FN3O3S |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | 5-[(7-fluoro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(S(=O)(=O)N3CCc4[nH]c5cc(F)ccc5c4C3)ccc2N1 |
| InChI | InChI=1S/C19H16FN3O3S/c20-12-1-3-14-15-10-23(6-5-17(15)21-18(14)9-12)27(25,26)13-2-4-16-11(7-13)8-19(24)22-16/h1-4,7,9,21H,5-6,8,10H2,(H,22,24) |
| InChIKey | XWLGEUUBRLRNJP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|