C20H19N3O4S — CID 113089377
5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one (PubChem CID 113089377) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one.
| Compound Name | 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 113089377 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 5-[(8-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)sulfonyl]-1,3-dihydroindol-2-one |
| SMILES | COc1ccc2[nH]c3c(c2c1)CN(S(=O)(=O)c1ccc2c(c1)CC(=O)N2)CC3 |
| InChI | InChI=1S/C20H19N3O4S/c1-27-13-2-4-18-15(10-13)16-11-23(7-6-19(16)21-18)28(25,26)14-3-5-17-12(8-14)9-20(24)22-17/h2-5,8,10,21H,6-7,9,11H2,1H3,(H,22,24) |
| InChIKey | PRCPGMWSXWBGOS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|