C21H20N2O6S — CID 35407929
methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 35407929) has the molecular formula C21H20N2O6S and a molecular weight of 428.47 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 35407929 |
| Molecular Formula | C21H20N2O6S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | methyl 2-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(S(=O)(=O)c1ccc2c(c1)OCCO2)CC3 |
| InChI | InChI=1S/C21H20N2O6S/c1-27-21(24)13-2-4-17-15(10-13)16-12-23(7-6-18(16)22-17)30(25,26)14-3-5-19-20(11-14)29-9-8-28-19/h2-5,10-11,22H,6-9,12H2,1H3 |
| InChIKey | QAHRVPKFFKYTMT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 97.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|