C18H20N4O3 — CID 95312080
methyl 2-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 95312080) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 2-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 95312080 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | methyl 2-[(1R)-1-(5-methyl-1,3,4-oxadiazol-2-yl)ethyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN([C@H](C)c1nnc(C)o1)CC3 |
| InChI | InChI=1S/C18H20N4O3/c1-10(17-21-20-11(2)25-17)22-7-6-16-14(9-22)13-8-12(18(23)24-3)4-5-15(13)19-16/h4-5,8,10,19H,6-7,9H2,1-3H3/t10-/m1/s1 |
| InChIKey | KWOOEGCSJLYEFW-SNVBAGLBSA-N |
| XLogP | 2.77 |
| TPSA | 84.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|