C17H18N4O2S — CID 133335451
methyl 2-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 133335451) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl 2-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 133335451 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | methyl 2-(3-ethyl-1,2,4-thiadiazol-5-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCc1nsc(N2CCc3[nH]c4ccc(C(=O)OC)cc4c3C2)n1 |
| InChI | InChI=1S/C17H18N4O2S/c1-3-15-19-17(24-20-15)21-7-6-14-12(9-21)11-8-10(16(22)23-2)4-5-13(11)18-14/h4-5,8,18H,3,6-7,9H2,1-2H3 |
| InChIKey | ANWPVKLKUFIXQT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|