C19H19FN4O2 — CID 133418341
methyl 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 133418341) has the molecular formula C19H19FN4O2 and a molecular weight of 354.39 g/mol. Its IUPAC name is methyl 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 133418341 |
| Molecular Formula | C19H19FN4O2 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | methyl 2-(6-ethyl-5-fluoropyrimidin-4-yl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | CCc1ncnc(N2CCc3[nH]c4ccc(C(=O)OC)cc4c3C2)c1F |
| InChI | InChI=1S/C19H19FN4O2/c1-3-14-17(20)18(22-10-21-14)24-7-6-16-13(9-24)12-8-11(19(25)26-2)4-5-15(12)23-16/h4-5,8,10,23H,3,6-7,9H2,1-2H3 |
| InChIKey | GMUWZERKZZUBME-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|