C25H26N2O5 — CID 32756343
methyl 2-[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 32756343) has the molecular formula C25H26N2O5 and a molecular weight of 434.49 g/mol. Its IUPAC name is methyl 2-[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 32756343 |
| Molecular Formula | C25H26N2O5 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | methyl 2-[4-[[(2S)-oxolan-2-yl]methoxy]benzoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)c1ccc(OC[C@@H]2CCCO2)cc1)CC3 |
| InChI | InChI=1S/C25H26N2O5/c1-30-25(29)17-6-9-22-20(13-17)21-14-27(11-10-23(21)26-22)24(28)16-4-7-18(8-5-16)32-15-19-3-2-12-31-19/h4-9,13,19,26H,2-3,10-12,14-15H2,1H3/t19-/m0/s1 |
| InChIKey | ZMUIKQYNLAGFDB-IBGZPJMESA-N |
| XLogP | 3.71 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|