C15H20N2O3S — CID 113089353
8-methoxy-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole (PubChem CID 113089353) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is 8-methoxy-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole.
| Compound Name | 8-methoxy-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 113089353 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 8-methoxy-2-propylsulfonyl-1,3,4,5-tetrahydropyrido[4,3-b]indole |
| SMILES | CCCS(=O)(=O)N1CCc2[nH]c3ccc(OC)cc3c2C1 |
| InChI | InChI=1S/C15H20N2O3S/c1-3-8-21(18,19)17-7-6-15-13(10-17)12-9-11(20-2)4-5-14(12)16-15/h4-5,9,16H,3,6-8,10H2,1-2H3 |
| InChIKey | PFKXUGGFLOZUTN-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|