C16H22N2O3S — CID 113090234
2-butylsulfonyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 113090234) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is 2-butylsulfonyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-butylsulfonyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 113090234 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-butylsulfonyl-6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCS(=O)(=O)N1CCc2c([nH]c3ccc(OC)cc23)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-3-4-9-22(19,20)18-8-7-13-14-10-12(21-2)5-6-15(14)17-16(13)11-18/h5-6,10,17H,3-4,7-9,11H2,1-2H3 |
| InChIKey | CVPQTBPADOPRSH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|