C18H17Cl2N3O3S — CID 146387587
6-chloro-N-(3-chloro-5-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide (PubChem CID 146387587) has the molecular formula C18H17Cl2N3O3S and a molecular weight of 426.33 g/mol. Its IUPAC name is 6-chloro-N-(3-chloro-5-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide.
| Compound Name | 6-chloro-N-(3-chloro-5-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 146387587 |
| Molecular Formula | C18H17Cl2N3O3S |
| Molecular Weight | 426.33 g/mol |
| Exact Mass | 425.04 |
| IUPAC Name | 6-chloro-N-(3-chloro-5-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
| SMILES | COc1cc(Cl)cc(NS(=O)(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2)c1 |
| InChI | InChI=1S/C18H17Cl2N3O3S/c1-26-14-7-12(20)6-13(9-14)22-27(24,25)23-5-4-15-16-8-11(19)2-3-17(16)21-18(15)10-23/h2-3,6-9,21-22H,4-5,10H2,1H3 |
| InChIKey | MXBDPZSTPAPMRT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.33 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|