C19H19Cl2N3OS — CID 153405393
1-(3-chloro-5-methoxyphenyl)-N-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)sulfanyl]methanamine (PubChem CID 153405393) has the molecular formula C19H19Cl2N3OS and a molecular weight of 408.35 g/mol. Its IUPAC name is 1-(3-chloro-5-methoxyphenyl)-N-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)sulfanyl]methanamine.
| Compound Name | 1-(3-chloro-5-methoxyphenyl)-N-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)sulfanyl]methanamine |
|---|---|
| PubChem CID | 153405393 |
| Molecular Formula | C19H19Cl2N3OS |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 1-(3-chloro-5-methoxyphenyl)-N-[(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)sulfanyl]methanamine |
| SMILES | COc1cc(Cl)cc(CNSN2CCc3c([nH]c4ccc(Cl)cc34)C2)c1 |
| InChI | InChI=1S/C19H19Cl2N3OS/c1-25-15-7-12(6-14(21)8-15)10-22-26-24-5-4-16-17-9-13(20)2-3-18(17)23-19(16)11-24/h2-3,6-9,22-23H,4-5,10-11H2,1H3 |
| InChIKey | UVROSNCOPKRTOO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|