C19H15Cl3N2O — CID 146381498
2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,5-dichlorophenyl)ethanone (PubChem CID 146381498) has the molecular formula C19H15Cl3N2O and a molecular weight of 393.70 g/mol. Its IUPAC name is 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,5-dichlorophenyl)ethanone.
| Compound Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,5-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 146381498 |
| Molecular Formula | C19H15Cl3N2O |
| Molecular Weight | 393.70 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-(3,5-dichlorophenyl)ethanone |
| SMILES | O=C(CN1CCc2c([nH]c3ccc(Cl)cc23)C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H15Cl3N2O/c20-12-1-2-17-16(8-12)15-3-4-24(9-18(15)23-17)10-19(25)11-5-13(21)7-14(22)6-11/h1-2,5-8,23H,3-4,9-10H2 |
| InChIKey | PGVMFGSGDALVBE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.70 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|