C18H15Cl2N3O — CID 146387991
(3-amino-5-chlorophenyl)-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone (PubChem CID 146387991) has the molecular formula C18H15Cl2N3O and a molecular weight of 360.24 g/mol. Its IUPAC name is (3-amino-5-chlorophenyl)-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone.
| Compound Name | (3-amino-5-chlorophenyl)-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 146387991 |
| Molecular Formula | C18H15Cl2N3O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (3-amino-5-chlorophenyl)-(6-chloro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
| SMILES | Nc1cc(Cl)cc(C(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2)c1 |
| InChI | InChI=1S/C18H15Cl2N3O/c19-11-1-2-16-15(8-11)14-3-4-23(9-17(14)22-16)18(24)10-5-12(20)7-13(21)6-10/h1-2,5-8,22H,3-4,9,21H2 |
| InChIKey | RYMBGNAZTBYEIG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|