C24H23Cl2N5O2 — CID 42569414
6-chloro-N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42569414) has the molecular formula C24H23Cl2N5O2 and a molecular weight of 484.39 g/mol. Its IUPAC name is 6-chloro-N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42569414 |
| Molecular Formula | C24H23Cl2N5O2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 6-chloro-N-[2-[2-(5-chloro-1H-indol-3-yl)ethylamino]-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | O=C(CNC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H23Cl2N5O2/c25-15-1-3-20-18(9-15)14(11-28-20)5-7-27-23(32)12-29-24(33)31-8-6-17-19-10-16(26)2-4-21(19)30-22(17)13-31/h1-4,9-11,28,30H,5-8,12-13H2,(H,27,32)(H,29,33) |
| InChIKey | HLRKDCLTOJWKBS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|