C22H23ClN4O4 — CID 42570450
6-chloro-N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide (PubChem CID 42570450) has the molecular formula C22H23ClN4O4 and a molecular weight of 442.90 g/mol. Its IUPAC name is 6-chloro-N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide.
| Compound Name | 6-chloro-N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 42570450 |
| Molecular Formula | C22H23ClN4O4 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 6-chloro-N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)CNC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2)c1 |
| InChI | InChI=1S/C22H23ClN4O4/c1-30-14-4-6-20(31-2)18(10-14)26-21(28)11-24-22(29)27-8-7-15-16-9-13(23)3-5-17(16)25-19(15)12-27/h3-6,9-10,25H,7-8,11-12H2,1-2H3,(H,24,29)(H,26,28) |
| InChIKey | UUIGCNFMWSQJMZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|