C18H19ClN2O5 — CID 112998400
N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3,5-dimethoxybenzamide (PubChem CID 112998400) has the molecular formula C18H19ClN2O5 and a molecular weight of 378.81 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 112998400 |
| Molecular Formula | C18H19ClN2O5 |
| Molecular Weight | 378.81 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NCC(=O)Nc2cc(Cl)ccc2OC)c1 |
| InChI | InChI=1S/C18H19ClN2O5/c1-24-13-6-11(7-14(9-13)25-2)18(23)20-10-17(22)21-15-8-12(19)4-5-16(15)26-3/h4-9H,10H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | DGGJDPYHBRQPOZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.81 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |