C18H20N2O4 — CID 3503389
N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbenzamide (PubChem CID 3503389) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbenzamide.
| Compound Name | N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 3503389 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-3-methylbenzamide |
| SMILES | COc1ccc(OC)c(NC(=O)CNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-12-5-4-6-13(9-12)18(22)19-11-17(21)20-15-10-14(23-2)7-8-16(15)24-3/h4-10H,11H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | IAGKBLIXPWDQIR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |