C17H22ClN3O2 — CID 111508554
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 111508554) has the molecular formula C17H22ClN3O2 and a molecular weight of 335.83 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 111508554 |
| Molecular Formula | C17H22ClN3O2 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)N1CCCC(CO)C1 |
| InChI | InChI=1S/C17H22ClN3O2/c18-14-3-4-16-15(8-14)13(9-20-16)5-6-19-17(23)21-7-1-2-12(10-21)11-22/h3-4,8-9,12,20,22H,1-2,5-7,10-11H2,(H,19,23) |
| InChIKey | WYUXRHDCGKVVPT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |