C21H22ClN3O — CID 66832116
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-phenylpyrrolidine-3-carboxamide (PubChem CID 66832116) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 66832116 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-1-phenylpyrrolidine-3-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccc(Cl)cc12)C1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C21H22ClN3O/c22-17-6-7-20-19(12-17)15(13-24-20)8-10-23-21(26)16-9-11-25(14-16)18-4-2-1-3-5-18/h1-7,12-13,16,24H,8-11,14H2,(H,23,26) |
| InChIKey | XBTKYILRQNFQIW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |