C14H18ClN3O2 — CID 111508552
1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3-hydroxypropyl)urea (PubChem CID 111508552) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 111508552 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-[2-(5-chloro-1H-indol-3-yl)ethyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H18ClN3O2/c15-11-2-3-13-12(8-11)10(9-18-13)4-6-17-14(20)16-5-1-7-19/h2-3,8-9,18-19H,1,4-7H2,(H2,16,17,20) |
| InChIKey | BFNMGZJADMQVGW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|