C18H25ClN2O — CID 17271856
N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-ethylhexanamide (PubChem CID 17271856) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-ethylhexanamide.
| Compound Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-ethylhexanamide |
|---|---|
| PubChem CID | 17271856 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[2-(5-chloro-1H-indol-3-yl)ethyl]-2-ethylhexanamide |
| SMILES | CCCCC(CC)C(=O)NCCc1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C18H25ClN2O/c1-3-5-6-13(4-2)18(22)20-10-9-14-12-21-17-8-7-15(19)11-16(14)17/h7-8,11-13,21H,3-6,9-10H2,1-2H3,(H,20,22) |
| InChIKey | CSNFRFGPKZFEMU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |